About 8-chloro-2-methyl-5-[(E)-2-thiophen-2-ylprop-1-enyl]-3,4-dihydro-1H-pyrido[4,3-b]indole
8-chloro-2-methyl-5-[(E)-2-thiophen-2-ylprop-1-enyl]-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 59454994) has the molecular formula C19H19ClN2S
and a molecular weight of 342.90 g/mol. Its IUPAC name is 8-chloro-2-methyl-5-[(E)-2-thiophen-2-ylprop-1-enyl]-3,4-dihydro-1H-pyrido[4,3-b]indole.
Molecular Properties
| Compound Name | 8-chloro-2-methyl-5-[(E)-2-thiophen-2-ylprop-1-enyl]-3,4-dihydro-1H-pyrido[4,3-b]indole |
| PubChem CID | 59454994 |
| Molecular Formula | C19H19ClN2S |
| Molecular Weight | 342.90 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 8-chloro-2-methyl-5-[(E)-2-thiophen-2-ylprop-1-enyl]-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | C/C(=C\n1c2c(c3cc(Cl)ccc31)CN(C)CC2)c1cccs1 |
| InChI | InChI=1S/C19H19ClN2S/c1-13(19-4-3-9-23-19)11-22-17-6-5-14(20)10-15(17)16-12-21(2)8-7-18(16)22/h3-6,9-11H,7-8,12H2,1-2H3/b13-11+ |
| InChIKey | RBGXNADHMNUIIF-ACCUITESSA-N |
| XLogP | 5.36 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.90 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-chloro-2-methyl-5-[(E)-2-thiophen-2-ylprop-1-enyl]-3,4-dihydro-1H-pyrido[4,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-2-methyl-5-[(E)-2-thiophen-2-ylprop-1-enyl]-3,4-dihydro-1H-pyrido[4,3-b]indole?
The IUPAC name of 8-chloro-2-methyl-5-[(E)-2-thiophen-2-ylprop-1-enyl]-3,4-dihydro-1H-pyrido[4,3-b]indole (CID 59454994) is 8-chloro-2-methyl-5-[(E)-2-thiophen-2-ylprop-1-enyl]-3,4-dihydro-1H-pyrido[4,3-b]indole.
What is the SMILES notation for 8-chloro-2-methyl-5-[(E)-2-thiophen-2-ylprop-1-enyl]-3,4-dihydro-1H-pyrido[4,3-b]indole?
The canonical SMILES for 8-chloro-2-methyl-5-[(E)-2-thiophen-2-ylprop-1-enyl]-3,4-dihydro-1H-pyrido[4,3-b]indole is C/C(=C\n1c2c(c3cc(Cl)ccc31)CN(C)CC2)c1cccs1.
What is the InChIKey of 8-chloro-2-methyl-5-[(E)-2-thiophen-2-ylprop-1-enyl]-3,4-dihydro-1H-pyrido[4,3-b]indole?
The InChIKey is RBGXNADHMNUIIF-ACCUITESSA-N. The full InChI is InChI=1S/C19H19ClN2S/c1-13(19-4-3-9-23-19)11-22-17-6-5-14(20)10-15(17)16-12-21(2)8-7-18(16)22/h3-6,9-11H,7-8,12H2,1-2H3/b13-11+.
What are the key properties of 8-chloro-2-methyl-5-[(E)-2-thiophen-2-ylprop-1-enyl]-3,4-dihydro-1H-pyrido[4,3-b]indole?
8-chloro-2-methyl-5-[(E)-2-thiophen-2-ylprop-1-enyl]-3,4-dihydro-1H-pyrido[4,3-b]indole has a molecular weight of 342.90 g/mol, XLogP of 5.36, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-2-methyl-5-[(E)-2-thiophen-2-ylprop-1-enyl]-3,4-dihydro-1H-pyrido[4,3-b]indole is sourced from PubChem (CID 59454994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).