C21H17FN2O2 — CID 59455120
5-[2-(4-fluorophenyl)ethynyl]-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylic acid (PubChem CID 59455120) has the molecular formula C21H17FN2O2 and a molecular weight of 348.38 g/mol. Its IUPAC name is 5-[2-(4-fluorophenyl)ethynyl]-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylic acid.
| Compound Name | 5-[2-(4-fluorophenyl)ethynyl]-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylic acid |
|---|---|
| PubChem CID | 59455120 |
| Molecular Formula | C21H17FN2O2 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 5-[2-(4-fluorophenyl)ethynyl]-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylic acid |
| SMILES | CN1CCc2c(c3cc(C(=O)O)ccc3n2C#Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H17FN2O2/c1-23-10-9-20-18(13-23)17-12-15(21(25)26)4-7-19(17)24(20)11-8-14-2-5-16(22)6-3-14/h2-7,12H,9-10,13H2,1H3,(H,25,26) |
| InChIKey | KCTLWXIVLLXFEK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|