About 2-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]-3,4-dihydro-1H-pyrido[4,3-b]indole
2-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 59455181) has the molecular formula C21H22N2
and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]-3,4-dihydro-1H-pyrido[4,3-b]indole.
Molecular Properties
| Compound Name | 2-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]-3,4-dihydro-1H-pyrido[4,3-b]indole |
| PubChem CID | 59455181 |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 2-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | Cc1ccc(/C=C/n2c3c(c4ccccc42)CN(C)CC3)cc1 |
| InChI | InChI=1S/C21H22N2/c1-16-7-9-17(10-8-16)11-14-23-20-6-4-3-5-18(20)19-15-22(2)13-12-21(19)23/h3-11,14H,12-13,15H2,1-2H3/b14-11+ |
| InChIKey | FJOFAQDCTPDUPT-SDNWHVSQSA-N |
| XLogP | 4.57 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]-3,4-dihydro-1H-pyrido[4,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]-3,4-dihydro-1H-pyrido[4,3-b]indole?
The IUPAC name of 2-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]-3,4-dihydro-1H-pyrido[4,3-b]indole (CID 59455181) is 2-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]-3,4-dihydro-1H-pyrido[4,3-b]indole.
What is the SMILES notation for 2-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]-3,4-dihydro-1H-pyrido[4,3-b]indole?
The canonical SMILES for 2-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]-3,4-dihydro-1H-pyrido[4,3-b]indole is Cc1ccc(/C=C/n2c3c(c4ccccc42)CN(C)CC3)cc1.
What is the InChIKey of 2-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]-3,4-dihydro-1H-pyrido[4,3-b]indole?
The InChIKey is FJOFAQDCTPDUPT-SDNWHVSQSA-N. The full InChI is InChI=1S/C21H22N2/c1-16-7-9-17(10-8-16)11-14-23-20-6-4-3-5-18(20)19-15-22(2)13-12-21(19)23/h3-11,14H,12-13,15H2,1-2H3/b14-11+.
What are the key properties of 2-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]-3,4-dihydro-1H-pyrido[4,3-b]indole?
2-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]-3,4-dihydro-1H-pyrido[4,3-b]indole has a molecular weight of 302.42 g/mol, XLogP of 4.57, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]-3,4-dihydro-1H-pyrido[4,3-b]indole is sourced from PubChem (CID 59455181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).