C8H10F3N3O — CID 59455302
(1R)-1-[5-(2,2,2-trifluoroethoxy)pyrazin-2-yl]ethanamine (PubChem CID 59455302) has the molecular formula C8H10F3N3O and a molecular weight of 221.18 g/mol. Its IUPAC name is (1R)-1-[5-(2,2,2-trifluoroethoxy)pyrazin-2-yl]ethanamine.
| Compound Name | (1R)-1-[5-(2,2,2-trifluoroethoxy)pyrazin-2-yl]ethanamine |
|---|---|
| PubChem CID | 59455302 |
| Molecular Formula | C8H10F3N3O |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | (1R)-1-[5-(2,2,2-trifluoroethoxy)pyrazin-2-yl]ethanamine |
| SMILES | C[C@@H](N)c1cnc(OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C8H10F3N3O/c1-5(12)6-2-14-7(3-13-6)15-4-8(9,10)11/h2-3,5H,4,12H2,1H3/t5-/m1/s1 |
| InChIKey | SZJQBSUHMPDWMC-RXMQYKEDSA-N |
| XLogP | 1.44 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |