About 2-(1-adamantyl)-N-[[1-(3,3-dimethylbutyl)-4-fluoropiperidin-4-yl]methyl]acetamide
2-(1-adamantyl)-N-[[1-(3,3-dimethylbutyl)-4-fluoropiperidin-4-yl]methyl]acetamide (PubChem CID 59455800) has the molecular formula C24H41FN2O
and a molecular weight of 392.60 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[[1-(3,3-dimethylbutyl)-4-fluoropiperidin-4-yl]methyl]acetamide.
Molecular Properties
| Compound Name | 2-(1-adamantyl)-N-[[1-(3,3-dimethylbutyl)-4-fluoropiperidin-4-yl]methyl]acetamide |
| PubChem CID | 59455800 |
| Molecular Formula | C24H41FN2O |
| Molecular Weight | 392.60 g/mol |
| Exact Mass | 392.32 |
| IUPAC Name | 2-(1-adamantyl)-N-[[1-(3,3-dimethylbutyl)-4-fluoropiperidin-4-yl]methyl]acetamide |
| SMILES | CC(C)(C)CCN1CCC(F)(CNC(=O)CC23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C24H41FN2O/c1-22(2,3)4-7-27-8-5-24(25,6-9-27)17-26-21(28)16-23-13-18-10-19(14-23)12-20(11-18)15-23/h18-20H,4-17H2,1-3H3,(H,26,28) |
| InChIKey | CTZSUTIEESNONW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-adamantyl)-N-[[1-(3,3-dimethylbutyl)-4-fluoropiperidin-4-yl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)-N-[[1-(3,3-dimethylbutyl)-4-fluoropiperidin-4-yl]methyl]acetamide?
The IUPAC name of 2-(1-adamantyl)-N-[[1-(3,3-dimethylbutyl)-4-fluoropiperidin-4-yl]methyl]acetamide (CID 59455800) is 2-(1-adamantyl)-N-[[1-(3,3-dimethylbutyl)-4-fluoropiperidin-4-yl]methyl]acetamide.
What is the SMILES notation for 2-(1-adamantyl)-N-[[1-(3,3-dimethylbutyl)-4-fluoropiperidin-4-yl]methyl]acetamide?
The canonical SMILES for 2-(1-adamantyl)-N-[[1-(3,3-dimethylbutyl)-4-fluoropiperidin-4-yl]methyl]acetamide is CC(C)(C)CCN1CCC(F)(CNC(=O)CC23CC4CC(CC(C4)C2)C3)CC1.
What is the InChIKey of 2-(1-adamantyl)-N-[[1-(3,3-dimethylbutyl)-4-fluoropiperidin-4-yl]methyl]acetamide?
The InChIKey is CTZSUTIEESNONW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H41FN2O/c1-22(2,3)4-7-27-8-5-24(25,6-9-27)17-26-21(28)16-23-13-18-10-19(14-23)12-20(11-18)15-23/h18-20H,4-17H2,1-3H3,(H,26,28).
What are the key properties of 2-(1-adamantyl)-N-[[1-(3,3-dimethylbutyl)-4-fluoropiperidin-4-yl]methyl]acetamide?
2-(1-adamantyl)-N-[[1-(3,3-dimethylbutyl)-4-fluoropiperidin-4-yl]methyl]acetamide has a molecular weight of 392.60 g/mol, XLogP of 4.95, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)-N-[[1-(3,3-dimethylbutyl)-4-fluoropiperidin-4-yl]methyl]acetamide is sourced from PubChem (CID 59455800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).