About N-[[1-[(4-bromothiophen-3-yl)methyl]-4-fluoropiperidin-4-yl]methyl]-3,5-dichlorobenzamide
N-[[1-[(4-bromothiophen-3-yl)methyl]-4-fluoropiperidin-4-yl]methyl]-3,5-dichlorobenzamide (PubChem CID 59455827) has the molecular formula C18H18BrCl2FN2OS
and a molecular weight of 480.23 g/mol. Its IUPAC name is N-[[1-[(4-bromothiophen-3-yl)methyl]-4-fluoropiperidin-4-yl]methyl]-3,5-dichlorobenzamide.
Molecular Properties
| Compound Name | N-[[1-[(4-bromothiophen-3-yl)methyl]-4-fluoropiperidin-4-yl]methyl]-3,5-dichlorobenzamide |
| PubChem CID | 59455827 |
| Molecular Formula | C18H18BrCl2FN2OS |
| Molecular Weight | 480.23 g/mol |
| Exact Mass | 477.97 |
| IUPAC Name | N-[[1-[(4-bromothiophen-3-yl)methyl]-4-fluoropiperidin-4-yl]methyl]-3,5-dichlorobenzamide |
| SMILES | O=C(NCC1(F)CCN(Cc2cscc2Br)CC1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H18BrCl2FN2OS/c19-16-10-26-9-13(16)8-24-3-1-18(22,2-4-24)11-23-17(25)12-5-14(20)7-15(21)6-12/h5-7,9-10H,1-4,8,11H2,(H,23,25) |
| InChIKey | IAYUOKPZOISDIP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.23 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[1-[(4-bromothiophen-3-yl)methyl]-4-fluoropiperidin-4-yl]methyl]-3,5-dichlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-[(4-bromothiophen-3-yl)methyl]-4-fluoropiperidin-4-yl]methyl]-3,5-dichlorobenzamide?
The IUPAC name of N-[[1-[(4-bromothiophen-3-yl)methyl]-4-fluoropiperidin-4-yl]methyl]-3,5-dichlorobenzamide (CID 59455827) is N-[[1-[(4-bromothiophen-3-yl)methyl]-4-fluoropiperidin-4-yl]methyl]-3,5-dichlorobenzamide.
What is the SMILES notation for N-[[1-[(4-bromothiophen-3-yl)methyl]-4-fluoropiperidin-4-yl]methyl]-3,5-dichlorobenzamide?
The canonical SMILES for N-[[1-[(4-bromothiophen-3-yl)methyl]-4-fluoropiperidin-4-yl]methyl]-3,5-dichlorobenzamide is O=C(NCC1(F)CCN(Cc2cscc2Br)CC1)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of N-[[1-[(4-bromothiophen-3-yl)methyl]-4-fluoropiperidin-4-yl]methyl]-3,5-dichlorobenzamide?
The InChIKey is IAYUOKPZOISDIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18BrCl2FN2OS/c19-16-10-26-9-13(16)8-24-3-1-18(22,2-4-24)11-23-17(25)12-5-14(20)7-15(21)6-12/h5-7,9-10H,1-4,8,11H2,(H,23,25).
What are the key properties of N-[[1-[(4-bromothiophen-3-yl)methyl]-4-fluoropiperidin-4-yl]methyl]-3,5-dichlorobenzamide?
N-[[1-[(4-bromothiophen-3-yl)methyl]-4-fluoropiperidin-4-yl]methyl]-3,5-dichlorobenzamide has a molecular weight of 480.23 g/mol, XLogP of 5.55, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-[(4-bromothiophen-3-yl)methyl]-4-fluoropiperidin-4-yl]methyl]-3,5-dichlorobenzamide is sourced from PubChem (CID 59455827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).