C16H22O8 — CID 59456178
[6-(4-oxopentanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-oxopentanoate (PubChem CID 59456178) has the molecular formula C16H22O8 and a molecular weight of 342.34 g/mol. Its IUPAC name is [6-(4-oxopentanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-oxopentanoate.
| Compound Name | [6-(4-oxopentanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 59456178 |
| Molecular Formula | C16H22O8 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | [6-(4-oxopentanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)OC1COC2C(OC(=O)CCC(C)=O)COC12 |
| InChI | InChI=1S/C16H22O8/c1-9(17)3-5-13(19)23-11-7-21-16-12(8-22-15(11)16)24-14(20)6-4-10(2)18/h11-12,15-16H,3-8H2,1-2H3 |
| InChIKey | PGKUAPLSUUXZJF-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |