C27H55NO4S — CID 59456205
2-[[4-(2,2-diethylbutyl)-2,4,6-triethylnonanoyl]amino]-2-methylpropane-1-sulfonic acid (PubChem CID 59456205) has the molecular formula C27H55NO4S and a molecular weight of 489.81 g/mol. Its IUPAC name is 2-[[4-(2,2-diethylbutyl)-2,4,6-triethylnonanoyl]amino]-2-methylpropane-1-sulfonic acid.
| Compound Name | 2-[[4-(2,2-diethylbutyl)-2,4,6-triethylnonanoyl]amino]-2-methylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 59456205 |
| Molecular Formula | C27H55NO4S |
| Molecular Weight | 489.81 g/mol |
| Exact Mass | 489.39 |
| IUPAC Name | 2-[[4-(2,2-diethylbutyl)-2,4,6-triethylnonanoyl]amino]-2-methylpropane-1-sulfonic acid |
| SMILES | CCCC(CC)CC(CC)(CC(CC)C(=O)NC(C)(C)CS(=O)(=O)O)CC(CC)(CC)CC |
| InChI | InChI=1S/C27H55NO4S/c1-10-17-22(11-2)18-27(16-7,20-26(13-4,14-5)15-6)19-23(12-3)24(29)28-25(8,9)21-33(30,31)32/h22-23H,10-21H2,1-9H3,(H,28,29)(H,30,31,32) |
| InChIKey | QFWGNDQBLOGDOL-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.81 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|