C20H36O2 — CID 59456473
(2R,6S,8S)-2-butyl-3-methyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecane (PubChem CID 59456473) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is (2R,6S,8S)-2-butyl-3-methyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecane.
| Compound Name | (2R,6S,8S)-2-butyl-3-methyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 59456473 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | (2R,6S,8S)-2-butyl-3-methyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecane |
| SMILES | C=C[C@@H](C)CC[C@@H]1CCC[C@]2(CCC(C)[C@@H](CCCC)O2)O1 |
| InChI | InChI=1S/C20H36O2/c1-5-7-10-19-17(4)13-15-20(22-19)14-8-9-18(21-20)12-11-16(3)6-2/h6,16-19H,2,5,7-15H2,1,3-4H3/t16-,17?,18+,19-,20+/m1/s1 |
| InChIKey | FUTBDSBCRWRTAL-OWIYKUFQSA-N |
| XLogP | 5.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|