C17H30O2 — CID 59456475
(2S,6S,8R)-2-but-3-enyl-8-butyl-1,7-dioxaspiro[5.5]undecane (PubChem CID 59456475) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is (2S,6S,8R)-2-but-3-enyl-8-butyl-1,7-dioxaspiro[5.5]undecane.
| Compound Name | (2S,6S,8R)-2-but-3-enyl-8-butyl-1,7-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 59456475 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (2S,6S,8R)-2-but-3-enyl-8-butyl-1,7-dioxaspiro[5.5]undecane |
| SMILES | C=CCC[C@@H]1CCC[C@]2(CCC[C@@H](CCCC)O2)O1 |
| InChI | InChI=1S/C17H30O2/c1-3-5-9-15-11-7-13-17(18-15)14-8-12-16(19-17)10-6-4-2/h3,15-16H,1,4-14H2,2H3/t15-,16-,17+/m1/s1 |
| InChIKey | SUFMYYHGNXWTPA-ZACQAIPSSA-N |
| XLogP | 4.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|