C22H40O4 — CID 59456480
(E,2S,5S)-7-[(2R,6S,8S)-2-(3-hydroxypropyl)-3-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]-3,5-dimethylhept-3-en-2-ol (PubChem CID 59456480) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is (E,2S,5S)-7-[(2R,6S,8S)-2-(3-hydroxypropyl)-3-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]-3,5-dimethylhept-3-en-2-ol.
| Compound Name | (E,2S,5S)-7-[(2R,6S,8S)-2-(3-hydroxypropyl)-3-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]-3,5-dimethylhept-3-en-2-ol |
|---|---|
| PubChem CID | 59456480 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | (E,2S,5S)-7-[(2R,6S,8S)-2-(3-hydroxypropyl)-3-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]-3,5-dimethylhept-3-en-2-ol |
| SMILES | C/C(=C\[C@@H](C)CC[C@@H]1CCC[C@]2(CCC(C)[C@@H](CCCO)O2)O1)[C@H](C)O |
| InChI | InChI=1S/C22H40O4/c1-16(15-18(3)19(4)24)9-10-20-7-5-12-22(25-20)13-11-17(2)21(26-22)8-6-14-23/h15-17,19-21,23-24H,5-14H2,1-4H3/b18-15+/t16-,17?,19-,20-,21+,22-/m0/s1 |
| InChIKey | AFVPALVCPVBOTB-KWQLLRTOSA-N |
| XLogP | 4.58 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|