C15H17N3O5 — CID 59456909
(E)-3-[4-(2-ethoxy-2-oxoethyl)-2-oxo-3,5-dihydro-1H-pyrido[2,3-e][1,4]diazepin-7-yl]prop-2-enoic acid (PubChem CID 59456909) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is (E)-3-[4-(2-ethoxy-2-oxoethyl)-2-oxo-3,5-dihydro-1H-pyrido[2,3-e][1,4]diazepin-7-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(2-ethoxy-2-oxoethyl)-2-oxo-3,5-dihydro-1H-pyrido[2,3-e][1,4]diazepin-7-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59456909 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (E)-3-[4-(2-ethoxy-2-oxoethyl)-2-oxo-3,5-dihydro-1H-pyrido[2,3-e][1,4]diazepin-7-yl]prop-2-enoic acid |
| SMILES | CCOC(=O)CN1CC(=O)Nc2ncc(/C=C/C(=O)O)cc2C1 |
| InChI | InChI=1S/C15H17N3O5/c1-2-23-14(22)9-18-7-11-5-10(3-4-13(20)21)6-16-15(11)17-12(19)8-18/h3-6H,2,7-9H2,1H3,(H,20,21)(H,16,17,19)/b4-3+ |
| InChIKey | DGDCAEQUAWDVHF-ONEGZZNKSA-N |
| XLogP | 0.50 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|