About 1-[(2,4-dichlorophenyl)methyliminomethyl]naphthalene-2,7-diol
1-[(2,4-dichlorophenyl)methyliminomethyl]naphthalene-2,7-diol (PubChem CID 594576) has the molecular formula C18H13Cl2NO2
and a molecular weight of 346.21 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyliminomethyl]naphthalene-2,7-diol.
Molecular Properties
| Compound Name | 1-[(2,4-dichlorophenyl)methyliminomethyl]naphthalene-2,7-diol |
| PubChem CID | 594576 |
| Molecular Formula | C18H13Cl2NO2 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyliminomethyl]naphthalene-2,7-diol |
| SMILES | Oc1ccc2ccc(O)c(/C=N/Cc3ccc(Cl)cc3Cl)c2c1 |
| InChI | InChI=1S/C18H13Cl2NO2/c19-13-4-1-12(17(20)7-13)9-21-10-16-15-8-14(22)5-2-11(15)3-6-18(16)23/h1-8,10,22-23H,9H2/b21-10+ |
| InChIKey | LBDLGDFQLSYPMX-UFFVCSGVSA-N |
| XLogP | 5.18 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,4-dichlorophenyl)methyliminomethyl]naphthalene-2,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-dichlorophenyl)methyliminomethyl]naphthalene-2,7-diol?
The IUPAC name of 1-[(2,4-dichlorophenyl)methyliminomethyl]naphthalene-2,7-diol (CID 594576) is 1-[(2,4-dichlorophenyl)methyliminomethyl]naphthalene-2,7-diol.
What is the SMILES notation for 1-[(2,4-dichlorophenyl)methyliminomethyl]naphthalene-2,7-diol?
The canonical SMILES for 1-[(2,4-dichlorophenyl)methyliminomethyl]naphthalene-2,7-diol is Oc1ccc2ccc(O)c(/C=N/Cc3ccc(Cl)cc3Cl)c2c1.
What is the InChIKey of 1-[(2,4-dichlorophenyl)methyliminomethyl]naphthalene-2,7-diol?
The InChIKey is LBDLGDFQLSYPMX-UFFVCSGVSA-N. The full InChI is InChI=1S/C18H13Cl2NO2/c19-13-4-1-12(17(20)7-13)9-21-10-16-15-8-14(22)5-2-11(15)3-6-18(16)23/h1-8,10,22-23H,9H2/b21-10+.
What are the key properties of 1-[(2,4-dichlorophenyl)methyliminomethyl]naphthalene-2,7-diol?
1-[(2,4-dichlorophenyl)methyliminomethyl]naphthalene-2,7-diol has a molecular weight of 346.21 g/mol, XLogP of 5.18, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dichlorophenyl)methyliminomethyl]naphthalene-2,7-diol is sourced from PubChem (CID 594576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).