About 5-(furan-2-yl)-6-(2-methylsulfanylpyrimidin-4-yl)-3H-imidazo[4,5-b]pyrazine
5-(furan-2-yl)-6-(2-methylsulfanylpyrimidin-4-yl)-3H-imidazo[4,5-b]pyrazine (PubChem CID 59457611) has the molecular formula C14H10N6OS
and a molecular weight of 310.34 g/mol. Its IUPAC name is 5-(furan-2-yl)-6-(2-methylsulfanylpyrimidin-4-yl)-3H-imidazo[4,5-b]pyrazine.
Molecular Properties
| Compound Name | 5-(furan-2-yl)-6-(2-methylsulfanylpyrimidin-4-yl)-3H-imidazo[4,5-b]pyrazine |
| PubChem CID | 59457611 |
| Molecular Formula | C14H10N6OS |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 5-(furan-2-yl)-6-(2-methylsulfanylpyrimidin-4-yl)-3H-imidazo[4,5-b]pyrazine |
| SMILES | CSc1nccc(-c2nc3nc[nH]c3nc2-c2ccco2)n1 |
| InChI | InChI=1S/C14H10N6OS/c1-22-14-15-5-4-8(18-14)10-11(9-3-2-6-21-9)20-13-12(19-10)16-7-17-13/h2-7H,1H3,(H,16,17,19,20) |
| InChIKey | PJFSXDDNWTXLJK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 93.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(furan-2-yl)-6-(2-methylsulfanylpyrimidin-4-yl)-3H-imidazo[4,5-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(furan-2-yl)-6-(2-methylsulfanylpyrimidin-4-yl)-3H-imidazo[4,5-b]pyrazine?
The IUPAC name of 5-(furan-2-yl)-6-(2-methylsulfanylpyrimidin-4-yl)-3H-imidazo[4,5-b]pyrazine (CID 59457611) is 5-(furan-2-yl)-6-(2-methylsulfanylpyrimidin-4-yl)-3H-imidazo[4,5-b]pyrazine.
What is the SMILES notation for 5-(furan-2-yl)-6-(2-methylsulfanylpyrimidin-4-yl)-3H-imidazo[4,5-b]pyrazine?
The canonical SMILES for 5-(furan-2-yl)-6-(2-methylsulfanylpyrimidin-4-yl)-3H-imidazo[4,5-b]pyrazine is CSc1nccc(-c2nc3nc[nH]c3nc2-c2ccco2)n1.
What is the InChIKey of 5-(furan-2-yl)-6-(2-methylsulfanylpyrimidin-4-yl)-3H-imidazo[4,5-b]pyrazine?
The InChIKey is PJFSXDDNWTXLJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N6OS/c1-22-14-15-5-4-8(18-14)10-11(9-3-2-6-21-9)20-13-12(19-10)16-7-17-13/h2-7H,1H3,(H,16,17,19,20).
What are the key properties of 5-(furan-2-yl)-6-(2-methylsulfanylpyrimidin-4-yl)-3H-imidazo[4,5-b]pyrazine?
5-(furan-2-yl)-6-(2-methylsulfanylpyrimidin-4-yl)-3H-imidazo[4,5-b]pyrazine has a molecular weight of 310.34 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(furan-2-yl)-6-(2-methylsulfanylpyrimidin-4-yl)-3H-imidazo[4,5-b]pyrazine is sourced from PubChem (CID 59457611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).