C22H23FN4S — CID 59457801
4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-2-N-(3-methylbutyl)benzene-1,2-diamine (PubChem CID 59457801) has the molecular formula C22H23FN4S and a molecular weight of 394.52 g/mol. Its IUPAC name is 4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-2-N-(3-methylbutyl)benzene-1,2-diamine.
| Compound Name | 4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-2-N-(3-methylbutyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 59457801 |
| Molecular Formula | C22H23FN4S |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-2-N-(3-methylbutyl)benzene-1,2-diamine |
| SMILES | CC(C)CCNc1cc(-c2c(-c3ccc(F)cc3)nc3sccn23)ccc1N |
| InChI | InChI=1S/C22H23FN4S/c1-14(2)9-10-25-19-13-16(5-8-18(19)24)21-20(15-3-6-17(23)7-4-15)26-22-27(21)11-12-28-22/h3-8,11-14,25H,9-10,24H2,1-2H3 |
| InChIKey | JJCZSDNNGSFTDZ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|