C25H27NO5 — CID 59457898
2-O-tert-butyl 1-O-methyl (1R)-6-[(3-ethynylphenyl)methoxy]-3,4-dihydro-1H-isoquinoline-1,2-dicarboxylate (PubChem CID 59457898) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is 2-O-tert-butyl 1-O-methyl (1R)-6-[(3-ethynylphenyl)methoxy]-3,4-dihydro-1H-isoquinoline-1,2-dicarboxylate.
| Compound Name | 2-O-tert-butyl 1-O-methyl (1R)-6-[(3-ethynylphenyl)methoxy]-3,4-dihydro-1H-isoquinoline-1,2-dicarboxylate |
|---|---|
| PubChem CID | 59457898 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2-O-tert-butyl 1-O-methyl (1R)-6-[(3-ethynylphenyl)methoxy]-3,4-dihydro-1H-isoquinoline-1,2-dicarboxylate |
| SMILES | C#Cc1cccc(COc2ccc3c(c2)CCN(C(=O)OC(C)(C)C)[C@H]3C(=O)OC)c1 |
| InChI | InChI=1S/C25H27NO5/c1-6-17-8-7-9-18(14-17)16-30-20-10-11-21-19(15-20)12-13-26(22(21)23(27)29-5)24(28)31-25(2,3)4/h1,7-11,14-15,22H,12-13,16H2,2-5H3/t22-/m1/s1 |
| InChIKey | KAJBUTMBQZYFMA-JOCHJYFZSA-N |
| XLogP | 4.25 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|