About 3-acetyl-6,7,8-trifluoro-1H-quinolin-4-one
3-acetyl-6,7,8-trifluoro-1H-quinolin-4-one (PubChem CID 59457959) has the molecular formula C11H6F3NO2
and a molecular weight of 241.17 g/mol. Its IUPAC name is 3-acetyl-6,7,8-trifluoro-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 3-acetyl-6,7,8-trifluoro-1H-quinolin-4-one |
| PubChem CID | 59457959 |
| Molecular Formula | C11H6F3NO2 |
| Molecular Weight | 241.17 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 3-acetyl-6,7,8-trifluoro-1H-quinolin-4-one |
| SMILES | CC(=O)c1c[nH]c2c(F)c(F)c(F)cc2c1=O |
| InChI | InChI=1S/C11H6F3NO2/c1-4(16)6-3-15-10-5(11(6)17)2-7(12)8(13)9(10)14/h2-3H,1H3,(H,15,17) |
| InChIKey | ALYQESAQXAWGBH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.17 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-6,7,8-trifluoro-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-6,7,8-trifluoro-1H-quinolin-4-one?
The IUPAC name of 3-acetyl-6,7,8-trifluoro-1H-quinolin-4-one (CID 59457959) is 3-acetyl-6,7,8-trifluoro-1H-quinolin-4-one.
What is the SMILES notation for 3-acetyl-6,7,8-trifluoro-1H-quinolin-4-one?
The canonical SMILES for 3-acetyl-6,7,8-trifluoro-1H-quinolin-4-one is CC(=O)c1c[nH]c2c(F)c(F)c(F)cc2c1=O.
What is the InChIKey of 3-acetyl-6,7,8-trifluoro-1H-quinolin-4-one?
The InChIKey is ALYQESAQXAWGBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F3NO2/c1-4(16)6-3-15-10-5(11(6)17)2-7(12)8(13)9(10)14/h2-3H,1H3,(H,15,17).
What are the key properties of 3-acetyl-6,7,8-trifluoro-1H-quinolin-4-one?
3-acetyl-6,7,8-trifluoro-1H-quinolin-4-one has a molecular weight of 241.17 g/mol, XLogP of 2.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-6,7,8-trifluoro-1H-quinolin-4-one is sourced from PubChem (CID 59457959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).