C26H33Cl2N5O5S — CID 59458044
2,6-dichloro-4-methyl-1-oxido-N-[(3R)-3-[4-[[2-(2-oxo-1,3-oxazolidin-3-yl)acetyl]-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]pyridin-1-ium-3-carboxamide (PubChem CID 59458044) has the molecular formula C26H33Cl2N5O5S and a molecular weight of 598.55 g/mol. Its IUPAC name is 2,6-dichloro-4-methyl-1-oxido-N-[(3R)-3-[4-[[2-(2-oxo-1,3-oxazolidin-3-yl)acetyl]-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]pyridin-1-ium-3-carboxamide.
| Compound Name | 2,6-dichloro-4-methyl-1-oxido-N-[(3R)-3-[4-[[2-(2-oxo-1,3-oxazolidin-3-yl)acetyl]-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 59458044 |
| Molecular Formula | C26H33Cl2N5O5S |
| Molecular Weight | 598.55 g/mol |
| Exact Mass | 597.16 |
| IUPAC Name | 2,6-dichloro-4-methyl-1-oxido-N-[(3R)-3-[4-[[2-(2-oxo-1,3-oxazolidin-3-yl)acetyl]-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]pyridin-1-ium-3-carboxamide |
| SMILES | Cc1cc(Cl)[n+]([O-])c(Cl)c1C(=O)NCC[C@@H](C)N1CCC(N(Cc2ccsc2)C(=O)CN2CCOC2=O)CC1 |
| InChI | InChI=1S/C26H33Cl2N5O5S/c1-17-13-21(27)33(37)24(28)23(17)25(35)29-7-3-18(2)30-8-4-20(5-9-30)32(14-19-6-12-39-16-19)22(34)15-31-10-11-38-26(31)36/h6,12-13,16,18,20H,3-5,7-11,14-15H2,1-2H3,(H,29,35)/t18-/m1/s1 |
| InChIKey | QCZVOKMRLSSTDW-GOSISDBHSA-N |
| XLogP | 3.45 |
| TPSA | 109.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|