C24H32Cl2N6O3S — CID 59458129
N-[(3R)-3-[4-[acetamidocarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,6-dichloro-4-methylpyridine-3-carboxamide (PubChem CID 59458129) has the molecular formula C24H32Cl2N6O3S and a molecular weight of 555.53 g/mol. Its IUPAC name is N-[(3R)-3-[4-[acetamidocarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,6-dichloro-4-methylpyridine-3-carboxamide.
| Compound Name | N-[(3R)-3-[4-[acetamidocarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,6-dichloro-4-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 59458129 |
| Molecular Formula | C24H32Cl2N6O3S |
| Molecular Weight | 555.53 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | N-[(3R)-3-[4-[acetamidocarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,6-dichloro-4-methylpyridine-3-carboxamide |
| SMILES | CC(=O)NNC(=O)N(Cc1ccsc1)C1CCN([C@H](C)CCNC(=O)c2c(C)cc(Cl)nc2Cl)CC1 |
| InChI | InChI=1S/C24H32Cl2N6O3S/c1-15-12-20(25)28-22(26)21(15)23(34)27-8-4-16(2)31-9-5-19(6-10-31)32(13-18-7-11-36-14-18)24(35)30-29-17(3)33/h7,11-12,14,16,19H,4-6,8-10,13H2,1-3H3,(H,27,34)(H,29,33)(H,30,35)/t16-/m1/s1 |
| InChIKey | OOKKJDIRMHYVLR-MRXNPFEDSA-N |
| XLogP | 3.99 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|