C27H36ClN7OS — CID 59458144
6-chloro-N-[(3R)-3-[4-[(N-cyano-N'-cyclopropylcarbamimidoyl)-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide (PubChem CID 59458144) has the molecular formula C27H36ClN7OS and a molecular weight of 542.15 g/mol. Its IUPAC name is 6-chloro-N-[(3R)-3-[4-[(N-cyano-N'-cyclopropylcarbamimidoyl)-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[(3R)-3-[4-[(N-cyano-N'-cyclopropylcarbamimidoyl)-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 59458144 |
| Molecular Formula | C27H36ClN7OS |
| Molecular Weight | 542.15 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | 6-chloro-N-[(3R)-3-[4-[(N-cyano-N'-cyclopropylcarbamimidoyl)-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
| SMILES | Cc1cc(Cl)nc(C)c1C(=O)NCC[C@@H](C)N1CCC(N(Cc2ccsc2)/C(=N/C2CC2)NC#N)CC1 |
| InChI | InChI=1S/C27H36ClN7OS/c1-18-14-24(28)32-20(3)25(18)26(36)30-10-6-19(2)34-11-7-23(8-12-34)35(15-21-9-13-37-16-21)27(31-17-29)33-22-4-5-22/h9,13-14,16,19,22-23H,4-8,10-12,15H2,1-3H3,(H,30,36)(H,31,33)/t19-/m1/s1 |
| InChIKey | WHLOHIYSCJQMFW-LJQANCHMSA-N |
| XLogP | 4.48 |
| TPSA | 96.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.15 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|