C29H42ClN5O4S — CID 59458160
ethyl 4-[[[1-[(2R)-4-[(6-chloro-2,4-dimethylpyridine-3-carbonyl)amino]butan-2-yl]piperidin-4-yl]-(thiophen-3-ylmethyl)carbamoyl]amino]butanoate (PubChem CID 59458160) has the molecular formula C29H42ClN5O4S and a molecular weight of 592.21 g/mol. Its IUPAC name is ethyl 4-[[[1-[(2R)-4-[(6-chloro-2,4-dimethylpyridine-3-carbonyl)amino]butan-2-yl]piperidin-4-yl]-(thiophen-3-ylmethyl)carbamoyl]amino]butanoate.
| Compound Name | ethyl 4-[[[1-[(2R)-4-[(6-chloro-2,4-dimethylpyridine-3-carbonyl)amino]butan-2-yl]piperidin-4-yl]-(thiophen-3-ylmethyl)carbamoyl]amino]butanoate |
|---|---|
| PubChem CID | 59458160 |
| Molecular Formula | C29H42ClN5O4S |
| Molecular Weight | 592.21 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | ethyl 4-[[[1-[(2R)-4-[(6-chloro-2,4-dimethylpyridine-3-carbonyl)amino]butan-2-yl]piperidin-4-yl]-(thiophen-3-ylmethyl)carbamoyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)N(Cc1ccsc1)C1CCN([C@H](C)CCNC(=O)c2c(C)cc(Cl)nc2C)CC1 |
| InChI | InChI=1S/C29H42ClN5O4S/c1-5-39-26(36)7-6-12-32-29(38)35(18-23-11-16-40-19-23)24-9-14-34(15-10-24)21(3)8-13-31-28(37)27-20(2)17-25(30)33-22(27)4/h11,16-17,19,21,24H,5-10,12-15,18H2,1-4H3,(H,31,37)(H,32,38)/t21-/m1/s1 |
| InChIKey | UODNLNCEQPOBOP-OAQYLSRUSA-N |
| XLogP | 4.94 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.21 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|