C29H36ClN5O2S — CID 59458186
6-chloro-2,4-dimethyl-N-[3-[4-[phenylcarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]pyridine-3-carboxamide (PubChem CID 59458186) has the molecular formula C29H36ClN5O2S and a molecular weight of 554.16 g/mol. Its IUPAC name is 6-chloro-2,4-dimethyl-N-[3-[4-[phenylcarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-2,4-dimethyl-N-[3-[4-[phenylcarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59458186 |
| Molecular Formula | C29H36ClN5O2S |
| Molecular Weight | 554.16 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | 6-chloro-2,4-dimethyl-N-[3-[4-[phenylcarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]pyridine-3-carboxamide |
| SMILES | Cc1cc(Cl)nc(C)c1C(=O)NCCC(C)N1CCC(N(Cc2ccsc2)C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C29H36ClN5O2S/c1-20-17-26(30)32-22(3)27(20)28(36)31-13-9-21(2)34-14-10-25(11-15-34)35(18-23-12-16-38-19-23)29(37)33-24-7-5-4-6-8-24/h4-8,12,16-17,19,21,25H,9-11,13-15,18H2,1-3H3,(H,31,36)(H,33,37) |
| InChIKey | CJRYYIHLHGESBB-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.16 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|