C26H33ClN4O2S — CID 59458202
6-chloro-2,4-dimethyl-N-[3-[4-[(4R)-4-phenyl-2-sulfanylidene-1,3-oxazolidin-3-yl]piperidin-1-yl]butyl]pyridine-3-carboxamide (PubChem CID 59458202) has the molecular formula C26H33ClN4O2S and a molecular weight of 501.10 g/mol. Its IUPAC name is 6-chloro-2,4-dimethyl-N-[3-[4-[(4R)-4-phenyl-2-sulfanylidene-1,3-oxazolidin-3-yl]piperidin-1-yl]butyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-2,4-dimethyl-N-[3-[4-[(4R)-4-phenyl-2-sulfanylidene-1,3-oxazolidin-3-yl]piperidin-1-yl]butyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59458202 |
| Molecular Formula | C26H33ClN4O2S |
| Molecular Weight | 501.10 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 6-chloro-2,4-dimethyl-N-[3-[4-[(4R)-4-phenyl-2-sulfanylidene-1,3-oxazolidin-3-yl]piperidin-1-yl]butyl]pyridine-3-carboxamide |
| SMILES | Cc1cc(Cl)nc(C)c1C(=O)NCCC(C)N1CCC(N2C(=S)OC[C@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C26H33ClN4O2S/c1-17-15-23(27)29-19(3)24(17)25(32)28-12-9-18(2)30-13-10-21(11-14-30)31-22(16-33-26(31)34)20-7-5-4-6-8-20/h4-8,15,18,21-22H,9-14,16H2,1-3H3,(H,28,32)/t18?,22-/m0/s1 |
| InChIKey | ZUJQWAYCXNWPQL-YSYXNDDBSA-N |
| XLogP | 4.68 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.10 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|