C23H36O4S — CID 59458267
[(2R,4S,6R,7R)-8,10,10-trideuterio-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-methylsulfanylacetate (PubChem CID 59458267) has the molecular formula C23H36O4S and a molecular weight of 411.62 g/mol. Its IUPAC name is [(2R,4S,6R,7R)-8,10,10-trideuterio-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-methylsulfanylacetate.
| Compound Name | [(2R,4S,6R,7R)-8,10,10-trideuterio-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-methylsulfanylacetate |
|---|---|
| PubChem CID | 59458267 |
| Molecular Formula | C23H36O4S |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | [(2R,4S,6R,7R)-8,10,10-trideuterio-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-methylsulfanylacetate |
| SMILES | [2H]C1([2H])CC23CCC(C)[C@@](C)([C@H](OC(=O)CSC)C[C@@](C)(C=C)C(O)[C@@H]2C)C3([2H])C1=O |
| InChI | InChI=1S/C23H36O4S/c1-7-21(4)12-17(27-18(25)13-28-6)22(5)14(2)8-10-23(15(3)20(21)26)11-9-16(24)19(22)23/h7,14-15,17,19-20,26H,1,8-13H2,2-6H3/t14?,15-,17+,19?,20?,21+,22-,23?/m0/s1/i9D2,19D |
| InChIKey | UYQJQBIRACZEIL-HBIURSGOSA-N |
| XLogP | 4.26 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|