About 2-methoxy-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]acetamide
2-methoxy-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]acetamide (PubChem CID 59458569) has the molecular formula C25H21F6NO2
and a molecular weight of 481.44 g/mol. Its IUPAC name is 2-methoxy-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]acetamide.
Molecular Properties
| Compound Name | 2-methoxy-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]acetamide |
| PubChem CID | 59458569 |
| Molecular Formula | C25H21F6NO2 |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 2-methoxy-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]acetamide |
| SMILES | COCC(=O)NC(Cc1ccccc1)(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H21F6NO2/c1-34-16-22(33)32-23(15-17-7-3-2-4-8-17,18-9-5-11-20(13-18)24(26,27)28)19-10-6-12-21(14-19)25(29,30)31/h2-14H,15-16H2,1H3,(H,32,33) |
| InChIKey | MYSURXHOCFZNQY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]acetamide?
The IUPAC name of 2-methoxy-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]acetamide (CID 59458569) is 2-methoxy-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]acetamide.
What is the SMILES notation for 2-methoxy-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]acetamide?
The canonical SMILES for 2-methoxy-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]acetamide is COCC(=O)NC(Cc1ccccc1)(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1.
What is the InChIKey of 2-methoxy-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]acetamide?
The InChIKey is MYSURXHOCFZNQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21F6NO2/c1-34-16-22(33)32-23(15-17-7-3-2-4-8-17,18-9-5-11-20(13-18)24(26,27)28)19-10-6-12-21(14-19)25(29,30)31/h2-14H,15-16H2,1H3,(H,32,33).
What are the key properties of 2-methoxy-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]acetamide?
2-methoxy-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]acetamide has a molecular weight of 481.44 g/mol, XLogP of 5.97, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]acetamide is sourced from PubChem (CID 59458569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).