C28H23F6NO4 — CID 59458667
methyl 4-[(2R)-2-(4-fluoro-3-propan-2-yloxyphenyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-isocyanoethyl]benzoate (PubChem CID 59458667) has the molecular formula C28H23F6NO4 and a molecular weight of 551.48 g/mol. Its IUPAC name is methyl 4-[(2R)-2-(4-fluoro-3-propan-2-yloxyphenyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-isocyanoethyl]benzoate.
| Compound Name | methyl 4-[(2R)-2-(4-fluoro-3-propan-2-yloxyphenyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-isocyanoethyl]benzoate |
|---|---|
| PubChem CID | 59458667 |
| Molecular Formula | C28H23F6NO4 |
| Molecular Weight | 551.48 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | methyl 4-[(2R)-2-(4-fluoro-3-propan-2-yloxyphenyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-isocyanoethyl]benzoate |
| SMILES | [C-]#[N+][C@@](Cc1ccc(C(=O)OC)cc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(F)c(OC(C)C)c1 |
| InChI | InChI=1S/C28H23F6NO4/c1-16(2)38-24-13-19(9-10-23(24)30)27(35-3,15-17-5-7-18(8-6-17)25(36)37-4)20-11-21(29)14-22(12-20)39-28(33,34)26(31)32/h5-14,16,26H,15H2,1-2,4H3/t27-/m1/s1 |
| InChIKey | FHMPHRQQOKNRNW-HHHXNRCGSA-N |
| XLogP | 7.18 |
| TPSA | 49.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.48 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|