About (3S)-3-propan-2-yl-2,2-bis(trifluoromethyl)oxirane
(3S)-3-propan-2-yl-2,2-bis(trifluoromethyl)oxirane (PubChem CID 59458777) has the molecular formula C7H8F6O
and a molecular weight of 222.13 g/mol. Its IUPAC name is (3S)-3-propan-2-yl-2,2-bis(trifluoromethyl)oxirane.
Molecular Properties
| Compound Name | (3S)-3-propan-2-yl-2,2-bis(trifluoromethyl)oxirane |
| PubChem CID | 59458777 |
| Molecular Formula | C7H8F6O |
| Molecular Weight | 222.13 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | (3S)-3-propan-2-yl-2,2-bis(trifluoromethyl)oxirane |
| SMILES | CC(C)[C@@H]1OC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H8F6O/c1-3(2)4-5(14-4,6(8,9)10)7(11,12)13/h3-4H,1-2H3/t4-/m0/s1 |
| InChIKey | DJTGJKZQHOKOJR-BYPYZUCNSA-N |
| XLogP | 2.90 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.13 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-propan-2-yl-2,2-bis(trifluoromethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-propan-2-yl-2,2-bis(trifluoromethyl)oxirane?
The IUPAC name of (3S)-3-propan-2-yl-2,2-bis(trifluoromethyl)oxirane (CID 59458777) is (3S)-3-propan-2-yl-2,2-bis(trifluoromethyl)oxirane.
What is the SMILES notation for (3S)-3-propan-2-yl-2,2-bis(trifluoromethyl)oxirane?
The canonical SMILES for (3S)-3-propan-2-yl-2,2-bis(trifluoromethyl)oxirane is CC(C)[C@@H]1OC1(C(F)(F)F)C(F)(F)F.
What is the InChIKey of (3S)-3-propan-2-yl-2,2-bis(trifluoromethyl)oxirane?
The InChIKey is DJTGJKZQHOKOJR-BYPYZUCNSA-N. The full InChI is InChI=1S/C7H8F6O/c1-3(2)4-5(14-4,6(8,9)10)7(11,12)13/h3-4H,1-2H3/t4-/m0/s1.
What are the key properties of (3S)-3-propan-2-yl-2,2-bis(trifluoromethyl)oxirane?
(3S)-3-propan-2-yl-2,2-bis(trifluoromethyl)oxirane has a molecular weight of 222.13 g/mol, XLogP of 2.90, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-propan-2-yl-2,2-bis(trifluoromethyl)oxirane is sourced from PubChem (CID 59458777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).