About [2-oxo-2-[[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl] acetate
[2-oxo-2-[[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl] acetate (PubChem CID 59458885) has the molecular formula C26H21F6NO3
and a molecular weight of 509.45 g/mol. Its IUPAC name is [2-oxo-2-[[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl] acetate.
Molecular Properties
| Compound Name | [2-oxo-2-[[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl] acetate |
| PubChem CID | 59458885 |
| Molecular Formula | C26H21F6NO3 |
| Molecular Weight | 509.45 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | [2-oxo-2-[[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl] acetate |
| SMILES | CC(=O)OCC(=O)NC(Cc1ccccc1)(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H21F6NO3/c1-17(34)36-16-23(35)33-24(15-18-7-3-2-4-8-18,19-9-5-11-21(13-19)25(27,28)29)20-10-6-12-22(14-20)26(30,31)32/h2-14H,15-16H2,1H3,(H,33,35) |
| InChIKey | CTHLOUNRZGUELE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.45 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-oxo-2-[[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-[[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl] acetate?
The IUPAC name of [2-oxo-2-[[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl] acetate (CID 59458885) is [2-oxo-2-[[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl] acetate.
What is the SMILES notation for [2-oxo-2-[[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl] acetate?
The canonical SMILES for [2-oxo-2-[[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl] acetate is CC(=O)OCC(=O)NC(Cc1ccccc1)(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1.
What is the InChIKey of [2-oxo-2-[[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl] acetate?
The InChIKey is CTHLOUNRZGUELE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21F6NO3/c1-17(34)36-16-23(35)33-24(15-18-7-3-2-4-8-18,19-9-5-11-21(13-19)25(27,28)29)20-10-6-12-22(14-20)26(30,31)32/h2-14H,15-16H2,1H3,(H,33,35).
What are the key properties of [2-oxo-2-[[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl] acetate?
[2-oxo-2-[[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl] acetate has a molecular weight of 509.45 g/mol, XLogP of 5.89, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-[[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl] acetate is sourced from PubChem (CID 59458885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).