About (2R)-4,4,4-trifluoro-2-propan-2-ylbutanamide
(2R)-4,4,4-trifluoro-2-propan-2-ylbutanamide (PubChem CID 59459083) has the molecular formula C7H12F3NO
and a molecular weight of 183.17 g/mol. Its IUPAC name is (2R)-4,4,4-trifluoro-2-propan-2-ylbutanamide.
Molecular Properties
| Compound Name | (2R)-4,4,4-trifluoro-2-propan-2-ylbutanamide |
| PubChem CID | 59459083 |
| Molecular Formula | C7H12F3NO |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (2R)-4,4,4-trifluoro-2-propan-2-ylbutanamide |
| SMILES | CC(C)[C@@H](CC(F)(F)F)C(N)=O |
| InChI | InChI=1S/C7H12F3NO/c1-4(2)5(6(11)12)3-7(8,9)10/h4-5H,3H2,1-2H3,(H2,11,12)/t5-/m1/s1 |
| InChIKey | GHDFRUHJHSWSOD-RXMQYKEDSA-N |
| XLogP | 1.70 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-4,4,4-trifluoro-2-propan-2-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4,4,4-trifluoro-2-propan-2-ylbutanamide?
The IUPAC name of (2R)-4,4,4-trifluoro-2-propan-2-ylbutanamide (CID 59459083) is (2R)-4,4,4-trifluoro-2-propan-2-ylbutanamide.
What is the SMILES notation for (2R)-4,4,4-trifluoro-2-propan-2-ylbutanamide?
The canonical SMILES for (2R)-4,4,4-trifluoro-2-propan-2-ylbutanamide is CC(C)[C@@H](CC(F)(F)F)C(N)=O.
What is the InChIKey of (2R)-4,4,4-trifluoro-2-propan-2-ylbutanamide?
The InChIKey is GHDFRUHJHSWSOD-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H12F3NO/c1-4(2)5(6(11)12)3-7(8,9)10/h4-5H,3H2,1-2H3,(H2,11,12)/t5-/m1/s1.
What are the key properties of (2R)-4,4,4-trifluoro-2-propan-2-ylbutanamide?
(2R)-4,4,4-trifluoro-2-propan-2-ylbutanamide has a molecular weight of 183.17 g/mol, XLogP of 1.70, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4,4,4-trifluoro-2-propan-2-ylbutanamide is sourced from PubChem (CID 59459083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).