C9H11F6NO2 — CID 59459500
1,1,1,3,3,3-hexafluoro-2-(3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl)propan-2-ol (PubChem CID 59459500) has the molecular formula C9H11F6NO2 and a molecular weight of 279.18 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 59459500 |
| Molecular Formula | C9H11F6NO2 |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl)propan-2-ol |
| SMILES | CC(C)C1=NOC(C(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C9H11F6NO2/c1-4(2)5-3-6(18-16-5)7(17,8(10,11)12)9(13,14)15/h4,6,17H,3H2,1-2H3 |
| InChIKey | FTMULODSYDMQIF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |