C26H18ClF6N3O3S — CID 59459510
1-(5-chloro-1,3-thiazol-2-yl)-3-[2-phenyl-1,1-bis[3-(trifluoromethoxy)phenyl]ethyl]urea (PubChem CID 59459510) has the molecular formula C26H18ClF6N3O3S and a molecular weight of 601.96 g/mol. Its IUPAC name is 1-(5-chloro-1,3-thiazol-2-yl)-3-[2-phenyl-1,1-bis[3-(trifluoromethoxy)phenyl]ethyl]urea.
| Compound Name | 1-(5-chloro-1,3-thiazol-2-yl)-3-[2-phenyl-1,1-bis[3-(trifluoromethoxy)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 59459510 |
| Molecular Formula | C26H18ClF6N3O3S |
| Molecular Weight | 601.96 g/mol |
| Exact Mass | 601.07 |
| IUPAC Name | 1-(5-chloro-1,3-thiazol-2-yl)-3-[2-phenyl-1,1-bis[3-(trifluoromethoxy)phenyl]ethyl]urea |
| SMILES | O=C(Nc1ncc(Cl)s1)NC(Cc1ccccc1)(c1cccc(OC(F)(F)F)c1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C26H18ClF6N3O3S/c27-21-15-34-23(40-21)35-22(37)36-24(14-16-6-2-1-3-7-16,17-8-4-10-19(12-17)38-25(28,29)30)18-9-5-11-20(13-18)39-26(31,32)33/h1-13,15H,14H2,(H2,34,35,36,37) |
| InChIKey | QHHAYRUEPDECKT-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.96 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |