About (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl)methyl carbonate
(2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl)methyl carbonate (PubChem CID 59459663) has the molecular formula C10H8N2O7
and a molecular weight of 268.18 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl)methyl carbonate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl)methyl carbonate |
| PubChem CID | 59459663 |
| Molecular Formula | C10H8N2O7 |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl)methyl carbonate |
| SMILES | O=C(OCN1C(=O)C=CC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C10H8N2O7/c13-6-1-2-7(14)11(6)5-18-10(17)19-12-8(15)3-4-9(12)16/h1-2H,3-5H2 |
| InChIKey | GXYKKGKMHPACOV-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl)methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl)methyl carbonate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl)methyl carbonate (CID 59459663) is (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl)methyl carbonate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl)methyl carbonate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl)methyl carbonate is O=C(OCN1C(=O)C=CC1=O)ON1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl)methyl carbonate?
The InChIKey is GXYKKGKMHPACOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O7/c13-6-1-2-7(14)11(6)5-18-10(17)19-12-8(15)3-4-9(12)16/h1-2H,3-5H2.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl)methyl carbonate?
(2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl)methyl carbonate has a molecular weight of 268.18 g/mol, XLogP of -0.91, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl)methyl carbonate is sourced from PubChem (CID 59459663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).