C74H68B2N4Pt — CID 59459712
bis(7-(3,6-dimethylcarbazol-9-yl)-5-[2,6-di(propan-2-yl)phenyl]-9H-[1]benzoborolo[3,2-b]pyridin-9-ide);platinum(2+) (PubChem CID 59459712) has the molecular formula C74H68B2N4Pt and a molecular weight of 1230.09 g/mol. Its IUPAC name is bis(7-(3,6-dimethylcarbazol-9-yl)-5-[2,6-di(propan-2-yl)phenyl]-9H-[1]benzoborolo[3,2-b]pyridin-9-ide);platinum(2+).
| Compound Name | bis(7-(3,6-dimethylcarbazol-9-yl)-5-[2,6-di(propan-2-yl)phenyl]-9H-[1]benzoborolo[3,2-b]pyridin-9-ide);platinum(2+) |
|---|---|
| PubChem CID | 59459712 |
| Molecular Formula | C74H68B2N4Pt |
| Molecular Weight | 1230.09 g/mol |
| Exact Mass | 1229.53 |
| IUPAC Name | bis(7-(3,6-dimethylcarbazol-9-yl)-5-[2,6-di(propan-2-yl)phenyl]-9H-[1]benzoborolo[3,2-b]pyridin-9-ide);platinum(2+) |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2-c1c[c-]c2c(c1)B(c1c(C(C)C)cccc1C(C)C)c1cccnc1-2.Cc1ccc2c(c1)c1cc(C)ccc1n2-c1c[c-]c2c(c1)B(c1c(C(C)C)cccc1C(C)C)c1cccnc1-2.[Pt+2] |
| InChI | InChI=1S/2C37H34BN2.Pt/c2*1-22(2)27-9-7-10-28(23(3)4)36(27)38-32-11-8-18-39-37(32)29-15-14-26(21-33(29)38)40-34-16-12-24(5)19-30(34)31-20-25(6)13-17-35(31)40;/h2*7-14,16-23H,1-6H3;/q2*-1;+2 |
| InChIKey | YVLRTUQHODDSMJ-UHFFFAOYSA-N |
| XLogP | 14.68 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1230.09 |
| LogP ≤ 5 | 14.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|