C16H11N3 — CID 59459758
5-pyridin-3-ylpyrido[3,2-b]indole (PubChem CID 59459758) has the molecular formula C16H11N3 and a molecular weight of 245.29 g/mol. Its IUPAC name is 5-pyridin-3-ylpyrido[3,2-b]indole.
| Compound Name | 5-pyridin-3-ylpyrido[3,2-b]indole |
|---|---|
| PubChem CID | 59459758 |
| Molecular Formula | C16H11N3 |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 5-pyridin-3-ylpyrido[3,2-b]indole |
| SMILES | c1cncc(-n2c3ccccc3c3ncccc32)c1 |
| InChI | InChI=1S/C16H11N3/c1-2-7-14-13(6-1)16-15(8-4-10-18-16)19(14)12-5-3-9-17-11-12/h1-11H |
| InChIKey | FTQJUCVZBNIFLK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |