C23H30F3N5O4 — CID 59459966
tert-butyl (2S)-2-[[2-(diethylamino)-5-(2,2,2-trifluoroethyl)pyrimidin-4-yl]amino]-3-(4-nitrophenyl)propanoate (PubChem CID 59459966) has the molecular formula C23H30F3N5O4 and a molecular weight of 497.52 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[2-(diethylamino)-5-(2,2,2-trifluoroethyl)pyrimidin-4-yl]amino]-3-(4-nitrophenyl)propanoate.
| Compound Name | tert-butyl (2S)-2-[[2-(diethylamino)-5-(2,2,2-trifluoroethyl)pyrimidin-4-yl]amino]-3-(4-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 59459966 |
| Molecular Formula | C23H30F3N5O4 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | tert-butyl (2S)-2-[[2-(diethylamino)-5-(2,2,2-trifluoroethyl)pyrimidin-4-yl]amino]-3-(4-nitrophenyl)propanoate |
| SMILES | CCN(CC)c1ncc(CC(F)(F)F)c(N[C@@H](Cc2ccc([N+](=O)[O-])cc2)C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C23H30F3N5O4/c1-6-30(7-2)21-27-14-16(13-23(24,25)26)19(29-21)28-18(20(32)35-22(3,4)5)12-15-8-10-17(11-9-15)31(33)34/h8-11,14,18H,6-7,12-13H2,1-5H3,(H,27,28,29)/t18-/m0/s1 |
| InChIKey | KKELBJKTLOYBHT-SFHVURJKSA-N |
| XLogP | 4.70 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|