C28H34F3N7O4 — CID 59459995
tert-butyl (2S)-2-[[2-(diethylamino)-5-(2,2,2-trifluoroethyl)pyrimidin-4-yl]amino]-3-[4-[(3-nitro-2-pyridinyl)amino]phenyl]propanoate (PubChem CID 59459995) has the molecular formula C28H34F3N7O4 and a molecular weight of 589.62 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[2-(diethylamino)-5-(2,2,2-trifluoroethyl)pyrimidin-4-yl]amino]-3-[4-[(3-nitro-2-pyridinyl)amino]phenyl]propanoate.
| Compound Name | tert-butyl (2S)-2-[[2-(diethylamino)-5-(2,2,2-trifluoroethyl)pyrimidin-4-yl]amino]-3-[4-[(3-nitro-2-pyridinyl)amino]phenyl]propanoate |
|---|---|
| PubChem CID | 59459995 |
| Molecular Formula | C28H34F3N7O4 |
| Molecular Weight | 589.62 g/mol |
| Exact Mass | 589.26 |
| IUPAC Name | tert-butyl (2S)-2-[[2-(diethylamino)-5-(2,2,2-trifluoroethyl)pyrimidin-4-yl]amino]-3-[4-[(3-nitro-2-pyridinyl)amino]phenyl]propanoate |
| SMILES | CCN(CC)c1ncc(CC(F)(F)F)c(N[C@@H](Cc2ccc(Nc3ncccc3[N+](=O)[O-])cc2)C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C28H34F3N7O4/c1-6-37(7-2)26-33-17-19(16-28(29,30)31)23(36-26)35-21(25(39)42-27(3,4)5)15-18-10-12-20(13-11-18)34-24-22(38(40)41)9-8-14-32-24/h8-14,17,21H,6-7,15-16H2,1-5H3,(H,32,34)(H,33,35,36)/t21-/m0/s1 |
| InChIKey | SDFXZVYKHANTNL-NRFANRHFSA-N |
| XLogP | 5.84 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.62 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|