C14H18F6O — CID 59460064
1,1,1,3,3,3-hexafluoro-2-(3-methyl-1-adamantyl)propan-2-ol (PubChem CID 59460064) has the molecular formula C14H18F6O and a molecular weight of 316.29 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(3-methyl-1-adamantyl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(3-methyl-1-adamantyl)propan-2-ol |
|---|---|
| PubChem CID | 59460064 |
| Molecular Formula | C14H18F6O |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(3-methyl-1-adamantyl)propan-2-ol |
| SMILES | CC12CC3CC(C1)CC(C(O)(C(F)(F)F)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C14H18F6O/c1-10-3-8-2-9(4-10)6-11(5-8,7-10)12(21,13(15,16)17)14(18,19)20/h8-9,21H,2-7H2,1H3 |
| InChIKey | FMVJQOFYCFJOPD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |