C22H23N7O4 — CID 59460362
(2R,3R,4S,5R)-2-[6-amino-8-[(4-pyridin-3-ylphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 59460362) has the molecular formula C22H23N7O4 and a molecular weight of 449.47 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-8-[(4-pyridin-3-ylphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-8-[(4-pyridin-3-ylphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 59460362 |
| Molecular Formula | C22H23N7O4 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-8-[(4-pyridin-3-ylphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1nc(NCc1ccc(-c3cccnc3)cc1)n2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H23N7O4/c23-19-16-20(27-11-26-19)29(21-18(32)17(31)15(10-30)33-21)22(28-16)25-8-12-3-5-13(6-4-12)14-2-1-7-24-9-14/h1-7,9,11,15,17-18,21,30-32H,8,10H2,(H,25,28)(H2,23,26,27)/t15-,17-,18-,21-/m1/s1 |
| InChIKey | SMRRGNCWJFQTPB-QTQZEZTPSA-N |
| XLogP | 0.69 |
| TPSA | 164.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |