About butoxy(tributyl)silane
butoxy(tributyl)silane (PubChem CID 594608) has the molecular formula C16H36OSi
and a molecular weight of 272.55 g/mol. Its IUPAC name is butoxy(tributyl)silane.
Molecular Properties
| Compound Name | butoxy(tributyl)silane |
| PubChem CID | 594608 |
| Molecular Formula | C16H36OSi |
| Molecular Weight | 272.55 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | butoxy(tributyl)silane |
| SMILES | CCCCO[Si](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H36OSi/c1-5-9-13-17-18(14-10-6-2,15-11-7-3)16-12-8-4/h5-16H2,1-4H3 |
| InChIKey | PEJKHFKRSDGAQY-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butoxy(tributyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butoxy(tributyl)silane?
The IUPAC name of butoxy(tributyl)silane (CID 594608) is butoxy(tributyl)silane.
What is the SMILES notation for butoxy(tributyl)silane?
The canonical SMILES for butoxy(tributyl)silane is CCCCO[Si](CCCC)(CCCC)CCCC.
What is the InChIKey of butoxy(tributyl)silane?
The InChIKey is PEJKHFKRSDGAQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36OSi/c1-5-9-13-17-18(14-10-6-2,15-11-7-3)16-12-8-4/h5-16H2,1-4H3.
What are the key properties of butoxy(tributyl)silane?
butoxy(tributyl)silane has a molecular weight of 272.55 g/mol, XLogP of 6.15, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butoxy(tributyl)silane is sourced from PubChem (CID 594608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).