C29H24F2N6O6 — CID 59460873
prop-2-enyl (1S)-1-[[5-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate (PubChem CID 59460873) has the molecular formula C29H24F2N6O6 and a molecular weight of 590.54 g/mol. Its IUPAC name is prop-2-enyl (1S)-1-[[5-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate.
| Compound Name | prop-2-enyl (1S)-1-[[5-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate |
|---|---|
| PubChem CID | 59460873 |
| Molecular Formula | C29H24F2N6O6 |
| Molecular Weight | 590.54 g/mol |
| Exact Mass | 590.17 |
| IUPAC Name | prop-2-enyl (1S)-1-[[5-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate |
| SMILES | C=CCOC(=O)c1ccc2c(c1C)CC[C@@H]2NC(=O)c1cc(C(=O)NCc2ccc3c(c2)OC(F)(F)O3)nc2ncnn12 |
| InChI | InChI=1S/C29H24F2N6O6/c1-3-10-41-27(40)18-5-6-19-17(15(18)2)7-8-20(19)35-26(39)22-12-21(36-28-33-14-34-37(22)28)25(38)32-13-16-4-9-23-24(11-16)43-29(30,31)42-23/h3-6,9,11-12,14,20H,1,7-8,10,13H2,2H3,(H,32,38)(H,35,39)/t20-/m0/s1 |
| InChIKey | GJQIBWBBULECJV-FQEVSTJZSA-N |
| XLogP | 3.44 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|