C29H24F5N5O5 — CID 59461056
5-N-[[3,4-bis(difluoromethoxy)phenyl]methyl]-3-fluoro-7-N-[(1S)-5-(1-hydroxyethenyl)-4-methyl-2,3-dihydro-1H-inden-1-yl]pyrazolo[1,5-a]pyrimidine-5,7-dicarboxamide (PubChem CID 59461056) has the molecular formula C29H24F5N5O5 and a molecular weight of 617.53 g/mol. Its IUPAC name is 5-N-[[3,4-bis(difluoromethoxy)phenyl]methyl]-3-fluoro-7-N-[(1S)-5-(1-hydroxyethenyl)-4-methyl-2,3-dihydro-1H-inden-1-yl]pyrazolo[1,5-a]pyrimidine-5,7-dicarboxamide.
| Compound Name | 5-N-[[3,4-bis(difluoromethoxy)phenyl]methyl]-3-fluoro-7-N-[(1S)-5-(1-hydroxyethenyl)-4-methyl-2,3-dihydro-1H-inden-1-yl]pyrazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
|---|---|
| PubChem CID | 59461056 |
| Molecular Formula | C29H24F5N5O5 |
| Molecular Weight | 617.53 g/mol |
| Exact Mass | 617.17 |
| IUPAC Name | 5-N-[[3,4-bis(difluoromethoxy)phenyl]methyl]-3-fluoro-7-N-[(1S)-5-(1-hydroxyethenyl)-4-methyl-2,3-dihydro-1H-inden-1-yl]pyrazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
| SMILES | C=C(O)c1ccc2c(c1C)CC[C@@H]2NC(=O)c1cc(C(=O)NCc2ccc(OC(F)F)c(OC(F)F)c2)nc2c(F)cnn12 |
| InChI | InChI=1S/C29H24F5N5O5/c1-13-16(14(2)40)4-5-18-17(13)6-7-20(18)38-27(42)22-10-21(37-25-19(30)12-36-39(22)25)26(41)35-11-15-3-8-23(43-28(31)32)24(9-15)44-29(33)34/h3-5,8-10,12,20,28-29,40H,2,6-7,11H2,1H3,(H,35,41)(H,38,42)/t20-/m0/s1 |
| InChIKey | QZMHZJWDAWMIQJ-FQEVSTJZSA-N |
| XLogP | 5.26 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|