C9H15F3N2O2 — CID 59461057
(2R)-4,4-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]pentanamide (PubChem CID 59461057) has the molecular formula C9H15F3N2O2 and a molecular weight of 240.22 g/mol. Its IUPAC name is (2R)-4,4-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]pentanamide.
| Compound Name | (2R)-4,4-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 59461057 |
| Molecular Formula | C9H15F3N2O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | (2R)-4,4-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]pentanamide |
| SMILES | CC(C)(C)C[C@@H](NC(=O)C(F)(F)F)C(N)=O |
| InChI | InChI=1S/C9H15F3N2O2/c1-8(2,3)4-5(6(13)15)14-7(16)9(10,11)12/h5H,4H2,1-3H3,(H2,13,15)(H,14,16)/t5-/m1/s1 |
| InChIKey | DBIQNTQRCDHMEK-RXMQYKEDSA-N |
| XLogP | 0.95 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |