C25H27FN8O4 — CID 59461210
7-N-[[4-(2,5-dioxoimidazolidin-4-yl)cyclohexyl]methyl]-5-N-[(4-fluoro-3-methylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide (PubChem CID 59461210) has the molecular formula C25H27FN8O4 and a molecular weight of 522.54 g/mol. Its IUPAC name is 7-N-[[4-(2,5-dioxoimidazolidin-4-yl)cyclohexyl]methyl]-5-N-[(4-fluoro-3-methylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide.
| Compound Name | 7-N-[[4-(2,5-dioxoimidazolidin-4-yl)cyclohexyl]methyl]-5-N-[(4-fluoro-3-methylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
|---|---|
| PubChem CID | 59461210 |
| Molecular Formula | C25H27FN8O4 |
| Molecular Weight | 522.54 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 7-N-[[4-(2,5-dioxoimidazolidin-4-yl)cyclohexyl]methyl]-5-N-[(4-fluoro-3-methylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
| SMILES | Cc1cc(CNC(=O)c2cc(C(=O)NCC3CCC(C4NC(=O)NC4=O)CC3)n3ncnc3n2)ccc1F |
| InChI | InChI=1S/C25H27FN8O4/c1-13-8-15(4-7-17(13)26)11-27-21(35)18-9-19(34-24(31-18)29-12-30-34)22(36)28-10-14-2-5-16(6-3-14)20-23(37)33-25(38)32-20/h4,7-9,12,14,16,20H,2-3,5-6,10-11H2,1H3,(H,27,35)(H,28,36)(H2,32,33,37,38) |
| InChIKey | DIWITKSUMNPKAX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 159.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.54 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|