C30H28N6O4 — CID 59461324
prop-2-enyl (1S)-1-[[5-[[(1S)-2,3-dihydro-1H-inden-1-yl]carbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate (PubChem CID 59461324) has the molecular formula C30H28N6O4 and a molecular weight of 536.59 g/mol. Its IUPAC name is prop-2-enyl (1S)-1-[[5-[[(1S)-2,3-dihydro-1H-inden-1-yl]carbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate.
| Compound Name | prop-2-enyl (1S)-1-[[5-[[(1S)-2,3-dihydro-1H-inden-1-yl]carbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate |
|---|---|
| PubChem CID | 59461324 |
| Molecular Formula | C30H28N6O4 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | prop-2-enyl (1S)-1-[[5-[[(1S)-2,3-dihydro-1H-inden-1-yl]carbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate |
| SMILES | C=CCOC(=O)c1ccc2c(c1C)CC[C@@H]2NC(=O)c1cc(C(=O)N[C@H]2CCc3ccccc32)nc2ncnn12 |
| InChI | InChI=1S/C30H28N6O4/c1-3-14-40-29(39)20-9-10-22-19(17(20)2)11-13-24(22)34-28(38)26-15-25(35-30-31-16-32-36(26)30)27(37)33-23-12-8-18-6-4-5-7-21(18)23/h3-7,9-10,15-16,23-24H,1,8,11-14H2,2H3,(H,33,37)(H,34,38)/t23-,24-/m0/s1 |
| InChIKey | CCIRCRJQMKTJTF-ZEQRLZLVSA-N |
| XLogP | 3.61 |
| TPSA | 127.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|