About 1-(1,2-dihydropyridin-6-yl)-2-methylpropan-1-one
1-(1,2-dihydropyridin-6-yl)-2-methylpropan-1-one (PubChem CID 59461420) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-(1,2-dihydropyridin-6-yl)-2-methylpropan-1-one.
Molecular Properties
| Compound Name | 1-(1,2-dihydropyridin-6-yl)-2-methylpropan-1-one |
| PubChem CID | 59461420 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 1-(1,2-dihydropyridin-6-yl)-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)C1=CC=CCN1 |
| InChI | InChI=1S/C9H13NO/c1-7(2)9(11)8-5-3-4-6-10-8/h3-5,7,10H,6H2,1-2H3 |
| InChIKey | MFSRYHNWUGKNTA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1,2-dihydropyridin-6-yl)-2-methylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-dihydropyridin-6-yl)-2-methylpropan-1-one?
The IUPAC name of 1-(1,2-dihydropyridin-6-yl)-2-methylpropan-1-one (CID 59461420) is 1-(1,2-dihydropyridin-6-yl)-2-methylpropan-1-one.
What is the SMILES notation for 1-(1,2-dihydropyridin-6-yl)-2-methylpropan-1-one?
The canonical SMILES for 1-(1,2-dihydropyridin-6-yl)-2-methylpropan-1-one is CC(C)C(=O)C1=CC=CCN1.
What is the InChIKey of 1-(1,2-dihydropyridin-6-yl)-2-methylpropan-1-one?
The InChIKey is MFSRYHNWUGKNTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-7(2)9(11)8-5-3-4-6-10-8/h3-5,7,10H,6H2,1-2H3.
What are the key properties of 1-(1,2-dihydropyridin-6-yl)-2-methylpropan-1-one?
1-(1,2-dihydropyridin-6-yl)-2-methylpropan-1-one has a molecular weight of 151.21 g/mol, XLogP of 1.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-dihydropyridin-6-yl)-2-methylpropan-1-one is sourced from PubChem (CID 59461420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).