C23H13F5N6O4 — CID 59462257
N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-7-[(2,3,4,5,6-pentafluorobenzoyl)amino]-5H-pyrrolo[3,2-d]pyrimidine-4-carboxamide (PubChem CID 59462257) has the molecular formula C23H13F5N6O4 and a molecular weight of 532.39 g/mol. Its IUPAC name is N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-7-[(2,3,4,5,6-pentafluorobenzoyl)amino]-5H-pyrrolo[3,2-d]pyrimidine-4-carboxamide.
| Compound Name | N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-7-[(2,3,4,5,6-pentafluorobenzoyl)amino]-5H-pyrrolo[3,2-d]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 59462257 |
| Molecular Formula | C23H13F5N6O4 |
| Molecular Weight | 532.39 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-7-[(2,3,4,5,6-pentafluorobenzoyl)amino]-5H-pyrrolo[3,2-d]pyrimidine-4-carboxamide |
| SMILES | O=C1COc2ccc(CNC(=O)c3ncnc4c(NC(=O)c5c(F)c(F)c(F)c(F)c5F)c[nH]c34)cc2N1 |
| InChI | InChI=1S/C23H13F5N6O4/c24-14-13(15(25)17(27)18(28)16(14)26)22(36)34-10-5-29-20-19(10)31-7-32-21(20)23(37)30-4-8-1-2-11-9(3-8)33-12(35)6-38-11/h1-3,5,7,29H,4,6H2,(H,30,37)(H,33,35)(H,34,36) |
| InChIKey | YPZAMHRUYVFDRJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 138.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|