C13H15N3O2 — CID 59462381
5-[(1S)-1-amino-4-methyl-2,3-dihydro-1H-inden-5-yl]imidazolidine-2,4-dione (PubChem CID 59462381) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 5-[(1S)-1-amino-4-methyl-2,3-dihydro-1H-inden-5-yl]imidazolidine-2,4-dione.
| Compound Name | 5-[(1S)-1-amino-4-methyl-2,3-dihydro-1H-inden-5-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59462381 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 5-[(1S)-1-amino-4-methyl-2,3-dihydro-1H-inden-5-yl]imidazolidine-2,4-dione |
| SMILES | Cc1c(C2NC(=O)NC2=O)ccc2c1CC[C@@H]2N |
| InChI | InChI=1S/C13H15N3O2/c1-6-7-4-5-10(14)9(7)3-2-8(6)11-12(17)16-13(18)15-11/h2-3,10-11H,4-5,14H2,1H3,(H2,15,16,17,18)/t10-,11?/m0/s1 |
| InChIKey | XMUJUZYKVSFNLQ-VUWPPUDQSA-N |
| XLogP | 0.82 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|