C26H20F4N10O3 — CID 59462432
5-N-[[4-fluoro-3-(trifluoromethoxy)phenyl]methyl]-7-N-[(1S)-5-(1-methyltetrazol-5-yl)-2,3-dihydro-1H-inden-1-yl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide (PubChem CID 59462432) has the molecular formula C26H20F4N10O3 and a molecular weight of 596.51 g/mol. Its IUPAC name is 5-N-[[4-fluoro-3-(trifluoromethoxy)phenyl]methyl]-7-N-[(1S)-5-(1-methyltetrazol-5-yl)-2,3-dihydro-1H-inden-1-yl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide.
| Compound Name | 5-N-[[4-fluoro-3-(trifluoromethoxy)phenyl]methyl]-7-N-[(1S)-5-(1-methyltetrazol-5-yl)-2,3-dihydro-1H-inden-1-yl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
|---|---|
| PubChem CID | 59462432 |
| Molecular Formula | C26H20F4N10O3 |
| Molecular Weight | 596.51 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | 5-N-[[4-fluoro-3-(trifluoromethoxy)phenyl]methyl]-7-N-[(1S)-5-(1-methyltetrazol-5-yl)-2,3-dihydro-1H-inden-1-yl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
| SMILES | Cn1nnnc1-c1ccc2c(c1)CC[C@@H]2NC(=O)c1cc(C(=O)NCc2ccc(F)c(OC(F)(F)F)c2)nc2ncnn12 |
| InChI | InChI=1S/C26H20F4N10O3/c1-39-22(36-37-38-39)15-3-5-16-14(9-15)4-7-18(16)34-24(42)20-10-19(35-25-32-12-33-40(20)25)23(41)31-11-13-2-6-17(27)21(8-13)43-26(28,29)30/h2-3,5-6,8-10,12,18H,4,7,11H2,1H3,(H,31,41)(H,34,42)/t18-/m0/s1 |
| InChIKey | QRXHVNQDGUKTIV-SFHVURJKSA-N |
| XLogP | 2.70 |
| TPSA | 154.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |