C27H21F4N5O4 — CID 59462626
7-N-[(1R,2R)-5-acetyl-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-fluoro-5-N-[[4-(trifluoromethyl)phenyl]methyl]pyrazolo[1,5-a]pyrimidine-5,7-dicarboxamide (PubChem CID 59462626) has the molecular formula C27H21F4N5O4 and a molecular weight of 555.49 g/mol. Its IUPAC name is 7-N-[(1R,2R)-5-acetyl-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-fluoro-5-N-[[4-(trifluoromethyl)phenyl]methyl]pyrazolo[1,5-a]pyrimidine-5,7-dicarboxamide.
| Compound Name | 7-N-[(1R,2R)-5-acetyl-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-fluoro-5-N-[[4-(trifluoromethyl)phenyl]methyl]pyrazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
|---|---|
| PubChem CID | 59462626 |
| Molecular Formula | C27H21F4N5O4 |
| Molecular Weight | 555.49 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | 7-N-[(1R,2R)-5-acetyl-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-fluoro-5-N-[[4-(trifluoromethyl)phenyl]methyl]pyrazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
| SMILES | CC(=O)c1ccc2c(c1)C[C@@H](O)[C@@H]2NC(=O)c1cc(C(=O)NCc2ccc(C(F)(F)F)cc2)nc2c(F)cnn12 |
| InChI | InChI=1S/C27H21F4N5O4/c1-13(37)15-4-7-18-16(8-15)9-22(38)23(18)35-26(40)21-10-20(34-24-19(28)12-33-36(21)24)25(39)32-11-14-2-5-17(6-3-14)27(29,30)31/h2-8,10,12,22-23,38H,9,11H2,1H3,(H,32,39)(H,35,40)/t22-,23-/m1/s1 |
| InChIKey | LIEZPTOWHLOSRM-DHIUTWEWSA-N |
| XLogP | 3.41 |
| TPSA | 125.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |