C29H20F6N4O3 — CID 59463358
N-[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide (PubChem CID 59463358) has the molecular formula C29H20F6N4O3 and a molecular weight of 586.49 g/mol. Its IUPAC name is N-[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | N-[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 59463358 |
| Molecular Formula | C29H20F6N4O3 |
| Molecular Weight | 586.49 g/mol |
| Exact Mass | 586.14 |
| IUPAC Name | N-[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1)N1N=C(c2cccnc2)CC1c1ccccc1O |
| InChI | InChI=1S/C29H20F6N4O3/c30-28(31,32)18-12-19(29(33,34)35)14-22(13-18)42-21-9-7-20(8-10-21)37-27(41)39-25(23-5-1-2-6-26(23)40)15-24(38-39)17-4-3-11-36-16-17/h1-14,16,25,40H,15H2,(H,37,41) |
| InChIKey | PGDQYBYLBLLTBA-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.49 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|